C24H29F2N5O4 — CID 162646223
2-(1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl)-N-[[2-(difluoromethoxy)phenyl]methyl]-N-[2-(methylamino)-2-oxoethyl]-1H-imidazole-5-carboxamide (PubChem CID 162646223) has the molecular formula C24H29F2N5O4 and a molecular weight of 489.52 g/mol. Its IUPAC name is 2-(1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl)-N-[[2-(difluoromethoxy)phenyl]methyl]-N-[2-(methylamino)-2-oxoethyl]-1H-imidazole-5-carboxamide.
| Compound Name | 2-(1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl)-N-[[2-(difluoromethoxy)phenyl]methyl]-N-[2-(methylamino)-2-oxoethyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 162646223 |
| Molecular Formula | C24H29F2N5O4 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-(1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl)-N-[[2-(difluoromethoxy)phenyl]methyl]-N-[2-(methylamino)-2-oxoethyl]-1H-imidazole-5-carboxamide |
| SMILES | CNC(=O)CN(Cc1ccccc1OC(F)F)C(=O)c1cnc(C(=O)N2CC3CCCCC3C2)[nH]1 |
| InChI | InChI=1S/C24H29F2N5O4/c1-27-20(32)14-31(13-17-8-4-5-9-19(17)35-24(25)26)22(33)18-10-28-21(29-18)23(34)30-11-15-6-2-3-7-16(15)12-30/h4-5,8-10,15-16,24H,2-3,6-7,11-14H2,1H3,(H,27,32)(H,28,29) |
| InChIKey | NIHPWKGBIKTWGP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 107.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |