C28H34ClN3O5S2 — CID 162646564
13-methoxy-6-methylidene-4,8-bis-(4-methylphenyl)sulfonyl-4,8,15-triazabicyclo[9.3.1]pentadeca-1(14),11(15),12-triene;hydrochloride (PubChem CID 162646564) has the molecular formula C28H34ClN3O5S2 and a molecular weight of 592.18 g/mol. Its IUPAC name is 13-methoxy-6-methylidene-4,8-bis-(4-methylphenyl)sulfonyl-4,8,15-triazabicyclo[9.3.1]pentadeca-1(14),11(15),12-triene;hydrochloride.
| Compound Name | 13-methoxy-6-methylidene-4,8-bis-(4-methylphenyl)sulfonyl-4,8,15-triazabicyclo[9.3.1]pentadeca-1(14),11(15),12-triene;hydrochloride |
|---|---|
| PubChem CID | 162646564 |
| Molecular Formula | C28H34ClN3O5S2 |
| Molecular Weight | 592.18 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 13-methoxy-6-methylidene-4,8-bis-(4-methylphenyl)sulfonyl-4,8,15-triazabicyclo[9.3.1]pentadeca-1(14),11(15),12-triene;hydrochloride |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)CCc2cc(OC)cc(n2)CCN(S(=O)(=O)c2ccc(C)cc2)C1.Cl |
| InChI | InChI=1S/C28H33N3O5S2.ClH/c1-21-5-9-27(10-6-21)37(32,33)30-15-13-24-17-26(36-4)18-25(29-24)14-16-31(20-23(3)19-30)38(34,35)28-11-7-22(2)8-12-28;/h5-12,17-18H,3,13-16,19-20H2,1-2,4H3;1H |
| InChIKey | ZCXWTLWQAVJEAL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.18 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|