About 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine
8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine (PubChem CID 162646658) has the molecular formula C16H19N3O
and a molecular weight of 269.35 g/mol. Its IUPAC name is 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine.
Molecular Properties
| Compound Name | 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine |
| PubChem CID | 162646658 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine |
| SMILES | COc1ccc2c(c1)CC(C)(C)c1c(N)nc(C)nc1-2 |
| InChI | InChI=1S/C16H19N3O/c1-9-18-14-12-6-5-11(20-4)7-10(12)8-16(2,3)13(14)15(17)19-9/h5-7H,8H2,1-4H3,(H2,17,18,19) |
| InChIKey | GAIABAJXPGBPTF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine?
The IUPAC name of 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine (CID 162646658) is 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine.
What is the SMILES notation for 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine?
The canonical SMILES for 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine is COc1ccc2c(c1)CC(C)(C)c1c(N)nc(C)nc1-2.
What is the InChIKey of 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine?
The InChIKey is GAIABAJXPGBPTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O/c1-9-18-14-12-6-5-11(20-4)7-10(12)8-16(2,3)13(14)15(17)19-9/h5-7H,8H2,1-4H3,(H2,17,18,19).
What are the key properties of 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine?
8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine has a molecular weight of 269.35 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-2,5,5-trimethyl-6H-benzo[h]quinazolin-4-amine is sourced from PubChem (CID 162646658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).