C19H24O2 — CID 162646731
(1R,4S,9S,10R,13S)-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-ene-6,14-dione (PubChem CID 162646731) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (1R,4S,9S,10R,13S)-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-ene-6,14-dione.
| Compound Name | (1R,4S,9S,10R,13S)-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-ene-6,14-dione |
|---|---|
| PubChem CID | 162646731 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (1R,4S,9S,10R,13S)-9,13-dimethyl-5-methylidenetetracyclo[11.2.1.01,10.04,9]hexadec-7-ene-6,14-dione |
| SMILES | C=C1C(=O)C=C[C@]2(C)[C@@H]1CC[C@@]13CC(=O)[C@@](C)(CC[C@H]12)C3 |
| InChI | InChI=1S/C19H24O2/c1-12-13-4-9-19-10-16(21)17(2,11-19)7-6-15(19)18(13,3)8-5-14(12)20/h5,8,13,15H,1,4,6-7,9-11H2,2-3H3/t13-,15+,17+,18-,19+/m1/s1 |
| InChIKey | AOZQVVJKWSEDBC-VXKGYBDPSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|