C36H27BF2IN3O2 — CID 162646800
3,3-difluoro-6-iodo-17-methoxy-5-(4-methoxyphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaene (PubChem CID 162646800) has the molecular formula C36H27BF2IN3O2 and a molecular weight of 709.34 g/mol. Its IUPAC name is 3,3-difluoro-6-iodo-17-methoxy-5-(4-methoxyphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaene.
| Compound Name | 3,3-difluoro-6-iodo-17-methoxy-5-(4-methoxyphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaene |
|---|---|
| PubChem CID | 162646800 |
| Molecular Formula | C36H27BF2IN3O2 |
| Molecular Weight | 709.34 g/mol |
| Exact Mass | 709.12 |
| IUPAC Name | 3,3-difluoro-6-iodo-17-methoxy-5-(4-methoxyphenyl)-7,11-diphenyl-2,9-diaza-4-azonia-3-boranuidapentacyclo[10.8.0.02,10.04,8.015,20]icosa-1(12),4,6,8,10,15(20),16,18-octaene |
| SMILES | COc1ccc(C2=[N+]3C(=Nc4c(-c5ccccc5)c5c(n4[B-]3(F)F)-c3ccc(OC)cc3CC5)C(c3ccccc3)=C2I)cc1 |
| InChI | InChI=1S/C36H27BF2IN3O2/c1-44-26-16-13-24(14-17-26)33-32(40)31(23-11-7-4-8-12-23)36-41-35-30(22-9-5-3-6-10-22)29-19-15-25-21-27(45-2)18-20-28(25)34(29)43(35)37(38,39)42(33)36/h3-14,16-18,20-21H,15,19H2,1-2H3 |
| InChIKey | NQXAMUFDUQZUGA-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 38.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.34 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|