C20H22O3 — CID 162646975
methyl (1S,2R,9R,12S)-4,12-dimethyl-14-methylidene-13-oxotetracyclo[10.2.1.01,9.03,8]pentadeca-3,5,7-triene-2-carboxylate (PubChem CID 162646975) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl (1S,2R,9R,12S)-4,12-dimethyl-14-methylidene-13-oxotetracyclo[10.2.1.01,9.03,8]pentadeca-3,5,7-triene-2-carboxylate.
| Compound Name | methyl (1S,2R,9R,12S)-4,12-dimethyl-14-methylidene-13-oxotetracyclo[10.2.1.01,9.03,8]pentadeca-3,5,7-triene-2-carboxylate |
|---|---|
| PubChem CID | 162646975 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methyl (1S,2R,9R,12S)-4,12-dimethyl-14-methylidene-13-oxotetracyclo[10.2.1.01,9.03,8]pentadeca-3,5,7-triene-2-carboxylate |
| SMILES | C=C1C(=O)[C@@]2(C)CC[C@@H]3c4cccc(C)c4[C@H](C(=O)OC)[C@@]13C2 |
| InChI | InChI=1S/C20H22O3/c1-11-6-5-7-13-14-8-9-19(3)10-20(14,12(2)17(19)21)16(15(11)13)18(22)23-4/h5-7,14,16H,2,8-10H2,1,3-4H3/t14-,16-,19+,20+/m1/s1 |
| InChIKey | LDYZSTREIJFJLC-NLCWTHGUSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|