About 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole
11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole (PubChem CID 162647043) has the molecular formula C25H23NO2
and a molecular weight of 369.46 g/mol. Its IUPAC name is 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole.
Molecular Properties
| Compound Name | 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole |
| PubChem CID | 162647043 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole |
| SMILES | COc1ccc2c(c1)c1ccc3c(c1n2Cc1ccccc1)C=CC(C)(C)O3 |
| InChI | InChI=1S/C25H23NO2/c1-25(2)14-13-20-23(28-25)12-10-19-21-15-18(27-3)9-11-22(21)26(24(19)20)16-17-7-5-4-6-8-17/h4-15H,16H2,1-3H3 |
| InChIKey | DCYQGTWCVFYHSK-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole?
The IUPAC name of 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole (CID 162647043) is 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole.
What is the SMILES notation for 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole?
The canonical SMILES for 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole is COc1ccc2c(c1)c1ccc3c(c1n2Cc1ccccc1)C=CC(C)(C)O3.
What is the InChIKey of 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole?
The InChIKey is DCYQGTWCVFYHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO2/c1-25(2)14-13-20-23(28-25)12-10-19-21-15-18(27-3)9-11-22(21)26(24(19)20)16-17-7-5-4-6-8-17/h4-15H,16H2,1-3H3.
What are the key properties of 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole?
11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole has a molecular weight of 369.46 g/mol, XLogP of 6.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-benzyl-8-methoxy-3,3-dimethylpyrano[3,2-a]carbazole is sourced from PubChem (CID 162647043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).