C22H23F3O8 — CID 162647104
[4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl] 4-(trifluoromethyl)benzoate (PubChem CID 162647104) has the molecular formula C22H23F3O8 and a molecular weight of 472.41 g/mol. Its IUPAC name is [4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 162647104 |
| Molecular Formula | C22H23F3O8 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl] 4-(trifluoromethyl)benzoate |
| SMILES | O=C(Oc1ccc(CCO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H23F3O8/c23-22(24,25)14-5-3-13(4-6-14)20(30)32-15-7-1-12(2-8-15)9-10-31-21-19(29)18(28)17(27)16(11-26)33-21/h1-8,16-19,21,26-29H,9-11H2/t16-,17-,18+,19-,21-/m1/s1 |
| InChIKey | ZZGISPLNTYPWQU-GQUPQBGVSA-N |
| XLogP | 1.28 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|