C16H18O6 — CID 162647217
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(2-hydroxynaphthalen-1-yl)oxane-3,4,5-triol (PubChem CID 162647217) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(2-hydroxynaphthalen-1-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(2-hydroxynaphthalen-1-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162647217 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(2-hydroxynaphthalen-1-yl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2c(O)ccc3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18O6/c17-7-11-13(19)14(20)15(21)16(22-11)12-9-4-2-1-3-8(9)5-6-10(12)18/h1-6,11,13-21H,7H2/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | WYLQSOCCEKSERS-JZYAIQKZSA-N |
| XLogP | 0.06 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |