C23H34N3NaO8S — CID 162647303
sodium (2S)-1-hydroxy-2-[[(2S)-4-methyl-2-(3-phenylpropoxycarbonylamino)pentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate (PubChem CID 162647303) has the molecular formula C23H34N3NaO8S and a molecular weight of 535.60 g/mol. Its IUPAC name is sodium (2S)-1-hydroxy-2-[[(2S)-4-methyl-2-(3-phenylpropoxycarbonylamino)pentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate.
| Compound Name | sodium (2S)-1-hydroxy-2-[[(2S)-4-methyl-2-(3-phenylpropoxycarbonylamino)pentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 162647303 |
| Molecular Formula | C23H34N3NaO8S |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | sodium (2S)-1-hydroxy-2-[[(2S)-4-methyl-2-(3-phenylpropoxycarbonylamino)pentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate |
| SMILES | CC(C)C[C@H](NC(=O)OCCCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(O)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C23H35N3O8S.Na/c1-15(2)13-18(26-23(30)34-12-6-9-16-7-4-3-5-8-16)21(28)25-19(22(29)35(31,32)33)14-17-10-11-24-20(17)27;/h3-5,7-8,15,17-19,22,29H,6,9-14H2,1-2H3,(H,24,27)(H,25,28)(H,26,30)(H,31,32,33);/q;+1/p-1/t17-,18-,19-,22?;/m0./s1 |
| InChIKey | OLJNLXSUJYNDGQ-FIGVUBRSSA-M |
| XLogP | -2.36 |
| TPSA | 173.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|