C18H22N4O3S — CID 162647311
N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 162647311) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 162647311 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)N3CC=CCC3)nc12 |
| InChI | InChI=1S/C18H22N4O3S/c1-24-14-6-5-13(21-9-11-25-12-10-21)16-15(14)19-17(26-16)20-18(23)22-7-3-2-4-8-22/h2-3,5-6H,4,7-12H2,1H3,(H,19,20,23) |
| InChIKey | SJFBTOOXZLJLKA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|