C23H19N3O2S — CID 162647330
5-[[4-[[4-(2-methylphenyl)phenyl]diazenyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 162647330) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 5-[[4-[[4-(2-methylphenyl)phenyl]diazenyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[4-(2-methylphenyl)phenyl]diazenyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 162647330 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-[[4-[[4-(2-methylphenyl)phenyl]diazenyl]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccccc1-c1ccc(/N=N/c2ccc(CC3SC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C23H19N3O2S/c1-15-4-2-3-5-20(15)17-8-12-19(13-9-17)26-25-18-10-6-16(7-11-18)14-21-22(27)24-23(28)29-21/h2-13,21H,14H2,1H3,(H,24,27,28)/b26-25+ |
| InChIKey | OHQAGSOPRWRIQH-OCEACIFDSA-N |
| XLogP | 5.97 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|