C17H14N4O3 — CID 162647383
4-[6-amino-5-(2-methoxypyrimidin-5-yl)-3-pyridinyl]benzoic acid (PubChem CID 162647383) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is 4-[6-amino-5-(2-methoxypyrimidin-5-yl)-3-pyridinyl]benzoic acid.
| Compound Name | 4-[6-amino-5-(2-methoxypyrimidin-5-yl)-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 162647383 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-[6-amino-5-(2-methoxypyrimidin-5-yl)-3-pyridinyl]benzoic acid |
| SMILES | COc1ncc(-c2cc(-c3ccc(C(=O)O)cc3)cnc2N)cn1 |
| InChI | InChI=1S/C17H14N4O3/c1-24-17-20-8-13(9-21-17)14-6-12(7-19-15(14)18)10-2-4-11(5-3-10)16(22)23/h2-9H,1H3,(H2,18,19)(H,22,23) |
| InChIKey | NIOQYHHHCUJZIQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |