C19H18FN5O4S — CID 162647437
(2S,3S,4R,5R)-5-[5-[2-(5-fluorothiophen-2-yl)ethynyl]-7-(methylamino)imidazo[4,5-b]pyridin-3-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 162647437) has the molecular formula C19H18FN5O4S and a molecular weight of 431.45 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[5-[2-(5-fluorothiophen-2-yl)ethynyl]-7-(methylamino)imidazo[4,5-b]pyridin-3-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[5-[2-(5-fluorothiophen-2-yl)ethynyl]-7-(methylamino)imidazo[4,5-b]pyridin-3-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 162647437 |
| Molecular Formula | C19H18FN5O4S |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (2S,3S,4R,5R)-5-[5-[2-(5-fluorothiophen-2-yl)ethynyl]-7-(methylamino)imidazo[4,5-b]pyridin-3-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(NC)cc(C#Cc4ccc(F)s4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H18FN5O4S/c1-21-11-7-9(3-4-10-5-6-12(20)30-10)24-17-13(11)23-8-25(17)19-15(27)14(26)16(29-19)18(28)22-2/h5-8,14-16,19,26-27H,1-2H3,(H,21,24)(H,22,28)/t14-,15+,16-,19+/m0/s1 |
| InChIKey | WXXFKKWTNMXWEC-CYJAXWMASA-N |
| XLogP | 0.44 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|