C16H16F3N7O4 — CID 162647520
5-amino-N-(2-aminoethyl)-2-(3-hydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 162647520) has the molecular formula C16H16F3N7O4 and a molecular weight of 427.34 g/mol. Its IUPAC name is 5-amino-N-(2-aminoethyl)-2-(3-hydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-amino-N-(2-aminoethyl)-2-(3-hydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162647520 |
| Molecular Formula | C16H16F3N7O4 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 5-amino-N-(2-aminoethyl)-2-(3-hydroxyphenyl)-[1,2,4]triazolo[1,5-c]pyrimidine-8-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCNC(=O)c1cnc(N)n2nc(-c3cccc(O)c3)nc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H15N7O2.C2HF3O2/c15-4-5-17-13(23)10-7-18-14(16)21-12(10)19-11(20-21)8-2-1-3-9(22)6-8;3-2(4,5)1(6)7/h1-3,6-7,22H,4-5,15H2,(H2,16,18)(H,17,23);(H,6,7) |
| InChIKey | XSFNUWGVEIYBQZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 181.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |