About 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid
2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 162647522) has the molecular formula C19H14F3NO4
and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid |
| PubChem CID | 162647522 |
| Molecular Formula | C19H14F3NO4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | O=C(O)CN1CC(=O)Oc2c(/C=C/c3ccc(C(F)(F)F)cc3)cccc21 |
| InChI | InChI=1S/C19H14F3NO4/c20-19(21,22)14-8-5-12(6-9-14)4-7-13-2-1-3-15-18(13)27-17(26)11-23(15)10-16(24)25/h1-9H,10-11H2,(H,24,25)/b7-4+ |
| InChIKey | HARGMXVTTDKSME-QPJJXVBHSA-N |
| XLogP | 3.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid?
The IUPAC name of 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid (CID 162647522) is 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid.
What is the SMILES notation for 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid?
The canonical SMILES for 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid is O=C(O)CN1CC(=O)Oc2c(/C=C/c3ccc(C(F)(F)F)cc3)cccc21.
What is the InChIKey of 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid?
The InChIKey is HARGMXVTTDKSME-QPJJXVBHSA-N. The full InChI is InChI=1S/C19H14F3NO4/c20-19(21,22)14-8-5-12(6-9-14)4-7-13-2-1-3-15-18(13)27-17(26)11-23(15)10-16(24)25/h1-9H,10-11H2,(H,24,25)/b7-4+.
What are the key properties of 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid?
2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid has a molecular weight of 377.32 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-oxo-8-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-3H-1,4-benzoxazin-4-yl]acetic acid is sourced from PubChem (CID 162647522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).