C28H47N — CID 162647667
(9Z,12Z)-N-[1-(3,5-dimethylphenyl)ethyl]octadeca-9,12-dien-1-amine (PubChem CID 162647667) has the molecular formula C28H47N and a molecular weight of 397.69 g/mol. Its IUPAC name is (9Z,12Z)-N-[1-(3,5-dimethylphenyl)ethyl]octadeca-9,12-dien-1-amine.
| Compound Name | (9Z,12Z)-N-[1-(3,5-dimethylphenyl)ethyl]octadeca-9,12-dien-1-amine |
|---|---|
| PubChem CID | 162647667 |
| Molecular Formula | C28H47N |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 397.37 |
| IUPAC Name | (9Z,12Z)-N-[1-(3,5-dimethylphenyl)ethyl]octadeca-9,12-dien-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCNC(C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C28H47N/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-29-27(4)28-23-25(2)22-26(3)24-28/h9-10,12-13,22-24,27,29H,5-8,11,14-21H2,1-4H3/b10-9-,13-12- |
| InChIKey | IEFIRQNYSAHWKL-UTJQPWESSA-N |
| XLogP | 8.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|