C13H15F3N8 — CID 162647682
2-N-(1-methylpyrazol-4-yl)-6-N-(4,4,4-trifluorobutyl)-7H-purine-2,6-diamine (PubChem CID 162647682) has the molecular formula C13H15F3N8 and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-N-(1-methylpyrazol-4-yl)-6-N-(4,4,4-trifluorobutyl)-7H-purine-2,6-diamine.
| Compound Name | 2-N-(1-methylpyrazol-4-yl)-6-N-(4,4,4-trifluorobutyl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 162647682 |
| Molecular Formula | C13H15F3N8 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-N-(1-methylpyrazol-4-yl)-6-N-(4,4,4-trifluorobutyl)-7H-purine-2,6-diamine |
| SMILES | Cn1cc(Nc2nc(NCCCC(F)(F)F)c3[nH]cnc3n2)cn1 |
| InChI | InChI=1S/C13H15F3N8/c1-24-6-8(5-20-24)21-12-22-10(9-11(23-12)19-7-18-9)17-4-2-3-13(14,15)16/h5-7H,2-4H2,1H3,(H3,17,18,19,21,22,23) |
| InChIKey | CNIDYPJGKPTGKF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|