C10H16O7 — CID 162647725
(4S)-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxolan-2-one (PubChem CID 162647725) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is (4S)-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxolan-2-one.
| Compound Name | (4S)-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxolan-2-one |
|---|---|
| PubChem CID | 162647725 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (4S)-4-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxolan-2-one |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2COC(=O)C2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16O7/c1-4-7(12)8(13)9(14)10(16-4)17-5-2-6(11)15-3-5/h4-5,7-10,12-14H,2-3H2,1H3/t4-,5-,7-,8+,9+,10-/m0/s1 |
| InChIKey | RHIHBFHPSXETFI-WMPDBJGWSA-N |
| XLogP | -1.85 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |