C38H43NO5S — CID 162647759
(2R,3S,4R,4aS,6R,10bS)-9-tert-butyl-6-imino-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide (PubChem CID 162647759) has the molecular formula C38H43NO5S and a molecular weight of 625.83 g/mol. Its IUPAC name is (2R,3S,4R,4aS,6R,10bS)-9-tert-butyl-6-imino-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide.
| Compound Name | (2R,3S,4R,4aS,6R,10bS)-9-tert-butyl-6-imino-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide |
|---|---|
| PubChem CID | 162647759 |
| Molecular Formula | C38H43NO5S |
| Molecular Weight | 625.83 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | (2R,3S,4R,4aS,6R,10bS)-9-tert-butyl-6-imino-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-2,3,4,4a,5,10b-hexahydrothiochromeno[4,3-b]pyran 6-oxide |
| SMILES | [H]N=[S@@]1(=O)C[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@@H]2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C38H43NO5S/c1-38(2,3)30-19-20-34-31(21-30)35-32(26-45(34,39)40)36(42-23-28-15-9-5-10-16-28)37(43-24-29-17-11-6-12-18-29)33(44-35)25-41-22-27-13-7-4-8-14-27/h4-21,32-33,35-37,39H,22-26H2,1-3H3/t32-,33+,35+,36+,37+,45+/m0/s1 |
| InChIKey | GXANPYLDZAABFF-RHNXXAJVSA-N |
| XLogP | 7.85 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.83 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |