About propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate
propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate (PubChem CID 162647793) has the molecular formula C14H19N5O2
and a molecular weight of 289.34 g/mol. Its IUPAC name is propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate |
| PubChem CID | 162647793 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate |
| SMILES | CC(C)OC(=O)Nc1cccc(-c2nncn2C(C)C)n1 |
| InChI | InChI=1S/C14H19N5O2/c1-9(2)19-8-15-18-13(19)11-6-5-7-12(16-11)17-14(20)21-10(3)4/h5-10H,1-4H3,(H,16,17,20) |
| InChIKey | GNPNOQNDUVOUBC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate?
The IUPAC name of propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate (CID 162647793) is propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate.
What is the SMILES notation for propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate?
The canonical SMILES for propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate is CC(C)OC(=O)Nc1cccc(-c2nncn2C(C)C)n1.
What is the InChIKey of propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate?
The InChIKey is GNPNOQNDUVOUBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2/c1-9(2)19-8-15-18-13(19)11-6-5-7-12(16-11)17-14(20)21-10(3)4/h5-10H,1-4H3,(H,16,17,20).
What are the key properties of propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate?
propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate has a molecular weight of 289.34 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]carbamate is sourced from PubChem (CID 162647793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).