C22H21ClF2O5S — CID 162647818
(2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-chloro-2-methoxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 162647818) has the molecular formula C22H21ClF2O5S and a molecular weight of 470.92 g/mol. Its IUPAC name is (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-chloro-2-methoxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-chloro-2-methoxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 162647818 |
| Molecular Formula | C22H21ClF2O5S |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | (2S,3R,4R,6R)-2-[5-(1-benzothiophen-2-ylmethyl)-4-chloro-2-methoxyphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | COc1cc(Cl)c(Cc2cc3ccccc3s2)cc1[C@@H]1O[C@H](CO)C(F)(F)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H21ClF2O5S/c1-29-16-9-15(23)12(7-13-6-11-4-2-3-5-17(11)31-13)8-14(16)20-19(27)21(28)22(24,25)18(10-26)30-20/h2-6,8-9,18-21,26-28H,7,10H2,1H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | SDJRROXRYCTJJZ-IVAOSVALSA-N |
| XLogP | 3.94 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |