C23H20ClN7O2S2 — CID 162647819
N-[2-[[4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-chlorobenzenesulfonamide (PubChem CID 162647819) has the molecular formula C23H20ClN7O2S2 and a molecular weight of 526.05 g/mol. Its IUPAC name is N-[2-[[4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[2-[[4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 162647819 |
| Molecular Formula | C23H20ClN7O2S2 |
| Molecular Weight | 526.05 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | N-[2-[[4-[6-(3-aminophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]-4-chlorobenzenesulfonamide |
| SMILES | Nc1cccc(-c2nc3sccn3c2-c2ccnc(NCCNS(=O)(=O)c3ccc(Cl)cc3)n2)c1 |
| InChI | InChI=1S/C23H20ClN7O2S2/c24-16-4-6-18(7-5-16)35(32,33)28-11-10-27-22-26-9-8-19(29-22)21-20(15-2-1-3-17(25)14-15)30-23-31(21)12-13-34-23/h1-9,12-14,28H,10-11,25H2,(H,26,27,29) |
| InChIKey | KTQCSNBCRNDWHV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.05 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|