About 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea
1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea (PubChem CID 162647847) has the molecular formula C22H22F2N6O
and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea |
| PubChem CID | 162647847 |
| Molecular Formula | C22H22F2N6O |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea |
| SMILES | CC(C)(C)c1cc(CNC(=O)Nc2cccc3[nH]ncc23)n(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C22H22F2N6O/c1-22(2,3)20-10-14(30(29-20)13-7-8-16(23)17(24)9-13)11-25-21(31)27-18-5-4-6-19-15(18)12-26-28-19/h4-10,12H,11H2,1-3H3,(H,26,28)(H2,25,27,31) |
| InChIKey | KRLAYTALCWVMAB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea?
The IUPAC name of 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea (CID 162647847) is 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea.
What is the SMILES notation for 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea?
The canonical SMILES for 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea is CC(C)(C)c1cc(CNC(=O)Nc2cccc3[nH]ncc23)n(-c2ccc(F)c(F)c2)n1.
What is the InChIKey of 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea?
The InChIKey is KRLAYTALCWVMAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F2N6O/c1-22(2,3)20-10-14(30(29-20)13-7-8-16(23)17(24)9-13)11-25-21(31)27-18-5-4-6-19-15(18)12-26-28-19/h4-10,12H,11H2,1-3H3,(H,26,28)(H2,25,27,31).
What are the key properties of 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea?
1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea has a molecular weight of 424.46 g/mol, XLogP of 4.65, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-tert-butyl-1-(3,4-difluorophenyl)pyrazol-5-yl]methyl]-3-(1H-indazol-4-yl)urea is sourced from PubChem (CID 162647847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).