C22H22F3N7OS — CID 162647870
4-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-N-[2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-3-yl]-1,3-thiazol-2-amine (PubChem CID 162647870) has the molecular formula C22H22F3N7OS and a molecular weight of 489.53 g/mol. Its IUPAC name is 4-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-N-[2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-3-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-N-[2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 162647870 |
| Molecular Formula | C22H22F3N7OS |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 4-[6-methoxy-5-(4-methylimidazol-1-yl)-2-pyridinyl]-N-[2-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazol-3-yl]-1,3-thiazol-2-amine |
| SMILES | COc1nc(-c2csc(Nc3c4c(nn3CC(F)(F)F)CCCC4)n2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C22H22F3N7OS/c1-13-9-31(12-26-13)18-8-7-16(27-20(18)33-2)17-10-34-21(28-17)29-19-14-5-3-4-6-15(14)30-32(19)11-22(23,24)25/h7-10,12H,3-6,11H2,1-2H3,(H,28,29) |
| InChIKey | LCWWSHWEQOZUDO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |