C17H22ClFO — CID 162647882
(2R,4aR,7R,8aR)-2-(4-chlorophenyl)-4-fluoro-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromene (PubChem CID 162647882) has the molecular formula C17H22ClFO and a molecular weight of 296.81 g/mol. Its IUPAC name is (2R,4aR,7R,8aR)-2-(4-chlorophenyl)-4-fluoro-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromene.
| Compound Name | (2R,4aR,7R,8aR)-2-(4-chlorophenyl)-4-fluoro-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromene |
|---|---|
| PubChem CID | 162647882 |
| Molecular Formula | C17H22ClFO |
| Molecular Weight | 296.81 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2R,4aR,7R,8aR)-2-(4-chlorophenyl)-4-fluoro-4,7-dimethyl-2,3,4a,5,6,7,8,8a-octahydrochromene |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H](c1ccc(Cl)cc1)CC2(C)F |
| InChI | InChI=1S/C17H22ClFO/c1-11-3-8-14-15(9-11)20-16(10-17(14,2)19)12-4-6-13(18)7-5-12/h4-7,11,14-16H,3,8-10H2,1-2H3/t11-,14-,15-,16-,17?/m1/s1 |
| InChIKey | VGBOOENMZWJELH-QJRZYCHDSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.81 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |