C30H48N4O3 — CID 162647978
(3S,6S,13E)-6-methyl-1-(3-methylbutyl)-3-(2-methylpropyl)-10-(3-phenylpropyl)-1,4,7,10-tetrazacyclopentadec-13-ene-2,5,9-trione (PubChem CID 162647978) has the molecular formula C30H48N4O3 and a molecular weight of 512.74 g/mol. Its IUPAC name is (3S,6S,13E)-6-methyl-1-(3-methylbutyl)-3-(2-methylpropyl)-10-(3-phenylpropyl)-1,4,7,10-tetrazacyclopentadec-13-ene-2,5,9-trione.
| Compound Name | (3S,6S,13E)-6-methyl-1-(3-methylbutyl)-3-(2-methylpropyl)-10-(3-phenylpropyl)-1,4,7,10-tetrazacyclopentadec-13-ene-2,5,9-trione |
|---|---|
| PubChem CID | 162647978 |
| Molecular Formula | C30H48N4O3 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.37 |
| IUPAC Name | (3S,6S,13E)-6-methyl-1-(3-methylbutyl)-3-(2-methylpropyl)-10-(3-phenylpropyl)-1,4,7,10-tetrazacyclopentadec-13-ene-2,5,9-trione |
| SMILES | CC(C)CCN1C/C=C/CCN(CCCc2ccccc2)C(=O)CN[C@@H](C)C(=O)N[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C30H48N4O3/c1-23(2)16-20-34-18-11-7-10-17-33(19-12-15-26-13-8-6-9-14-26)28(35)22-31-25(5)29(36)32-27(30(34)37)21-24(3)4/h6-9,11,13-14,23-25,27,31H,10,12,15-22H2,1-5H3,(H,32,36)/b11-7+/t25-,27-/m0/s1 |
| InChIKey | DVNAGGNSUHKMNV-WSSKNQENSA-N |
| XLogP | 3.79 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|