C28H39NO7 — CID 162648136
6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2,3,4,5-tetramethoxy-6-methylphenyl)hexan-1-one (PubChem CID 162648136) has the molecular formula C28H39NO7 and a molecular weight of 501.62 g/mol. Its IUPAC name is 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2,3,4,5-tetramethoxy-6-methylphenyl)hexan-1-one.
| Compound Name | 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2,3,4,5-tetramethoxy-6-methylphenyl)hexan-1-one |
|---|---|
| PubChem CID | 162648136 |
| Molecular Formula | C28H39NO7 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 6-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-1-(2,3,4,5-tetramethoxy-6-methylphenyl)hexan-1-one |
| SMILES | COc1cc2c(cc1OC)CN(CCCCCC(=O)c1c(C)c(OC)c(OC)c(OC)c1OC)CC2 |
| InChI | InChI=1S/C28H39NO7/c1-18-24(26(34-5)28(36-7)27(35-6)25(18)33-4)21(30)11-9-8-10-13-29-14-12-19-15-22(31-2)23(32-3)16-20(19)17-29/h15-16H,8-14,17H2,1-7H3 |
| InChIKey | RHDDAZNIYSRFOT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|