C23H28F4N6 — CID 162648239
N-(3-fluoropropyl)-N'-[6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-pyridinyl]ethane-1,2-diamine (PubChem CID 162648239) has the molecular formula C23H28F4N6 and a molecular weight of 464.51 g/mol. Its IUPAC name is N-(3-fluoropropyl)-N'-[6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-pyridinyl]ethane-1,2-diamine.
| Compound Name | N-(3-fluoropropyl)-N'-[6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 162648239 |
| Molecular Formula | C23H28F4N6 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | N-(3-fluoropropyl)-N'-[6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]-3-pyridinyl]ethane-1,2-diamine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2ccc(NCCNCCCF)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C23H28F4N6/c1-15-11-18-17(4-6-20-19(18)13-31-32-20)22(33(15)14-23(25,26)27)21-5-3-16(12-30-21)29-10-9-28-8-2-7-24/h3-6,12-13,15,22,28-29H,2,7-11,14H2,1H3,(H,31,32)/t15-,22+/m1/s1 |
| InChIKey | PUTTWXCQFZTZSR-QRQCRPRQSA-N |
| XLogP | 4.22 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|