About 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one
2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one (PubChem CID 162648250) has the molecular formula C20H16O6
and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one |
| PubChem CID | 162648250 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one |
| SMILES | COc1ccc(OC)c2c1c(OC)cc1c(=O)cc(-c3ccco3)oc12 |
| InChI | InChI=1S/C20H16O6/c1-22-14-6-7-15(23-2)19-18(14)17(24-3)9-11-12(21)10-16(26-20(11)19)13-5-4-8-25-13/h4-10H,1-3H3 |
| InChIKey | BMKHLBYRDLCJKA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one?
The IUPAC name of 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one (CID 162648250) is 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one.
What is the SMILES notation for 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one?
The canonical SMILES for 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one is COc1ccc(OC)c2c1c(OC)cc1c(=O)cc(-c3ccco3)oc12.
What is the InChIKey of 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one?
The InChIKey is BMKHLBYRDLCJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O6/c1-22-14-6-7-15(23-2)19-18(14)17(24-3)9-11-12(21)10-16(26-20(11)19)13-5-4-8-25-13/h4-10H,1-3H3.
What are the key properties of 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one?
2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one has a molecular weight of 352.34 g/mol, XLogP of 4.23, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-6,7,10-trimethoxybenzo[h]chromen-4-one is sourced from PubChem (CID 162648250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).