About 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile
4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile (PubChem CID 162648316) has the molecular formula C30H19N7
and a molecular weight of 477.53 g/mol. Its IUPAC name is 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile |
| PubChem CID | 162648316 |
| Molecular Formula | C30H19N7 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cn(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)nn2)cc1 |
| InChI | InChI=1S/C30H19N7/c31-19-21-7-9-23(10-8-21)30-20-37(36-35-30)25-13-11-22(12-14-25)24-17-28(26-5-1-3-15-32-26)34-29(18-24)27-6-2-4-16-33-27/h1-18,20H |
| InChIKey | IVZAFLVZOVJFTD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile?
The IUPAC name of 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile (CID 162648316) is 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile.
What is the SMILES notation for 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile?
The canonical SMILES for 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile is N#Cc1ccc(-c2cn(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)nn2)cc1.
What is the InChIKey of 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile?
The InChIKey is IVZAFLVZOVJFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H19N7/c31-19-21-7-9-23(10-8-21)30-20-37(36-35-30)25-13-11-22(12-14-25)24-17-28(26-5-1-3-15-32-26)34-29(18-24)27-6-2-4-16-33-27/h1-18,20H.
What are the key properties of 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile?
4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile has a molecular weight of 477.53 g/mol, XLogP of 5.99, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile is sourced from PubChem (CID 162648316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).