C30H19N7 — CID 162648316
4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile (PubChem CID 162648316) has the molecular formula C30H19N7 and a molecular weight of 477.53 g/mol. Its IUPAC name is 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile.
| Compound Name | 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 162648316 |
| Molecular Formula | C30H19N7 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-[1-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]triazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cn(-c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)nn2)cc1 |
| InChI | InChI=1S/C30H19N7/c31-19-21-7-9-23(10-8-21)30-20-37(36-35-30)25-13-11-22(12-14-25)24-17-28(26-5-1-3-15-32-26)34-29(18-24)27-6-2-4-16-33-27/h1-18,20H |
| InChIKey | IVZAFLVZOVJFTD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |