C16H17NO3 — CID 162648346
(3aS,9bS)-1-acetyl-6-methyl-3-methylidene-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]pyrrole-2,8-dione (PubChem CID 162648346) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (3aS,9bS)-1-acetyl-6-methyl-3-methylidene-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]pyrrole-2,8-dione.
| Compound Name | (3aS,9bS)-1-acetyl-6-methyl-3-methylidene-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]pyrrole-2,8-dione |
|---|---|
| PubChem CID | 162648346 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (3aS,9bS)-1-acetyl-6-methyl-3-methylidene-4,5,7,9b-tetrahydro-3aH-azuleno[4,5-b]pyrrole-2,8-dione |
| SMILES | C=C1C(=O)N(C(C)=O)[C@@H]2C3=CC(=O)CC3=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C16H17NO3/c1-8-4-5-12-9(2)16(20)17(10(3)18)15(12)14-7-11(19)6-13(8)14/h7,12,15H,2,4-6H2,1,3H3/t12-,15-/m0/s1 |
| InChIKey | JCPITAKUJXIWJK-WFASDCNBSA-N |
| XLogP | 1.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|