C11H13ClN4O4 — CID 162648429
(2R,3S,4R,5S)-2-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 162648429) has the molecular formula C11H13ClN4O4 and a molecular weight of 300.70 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5S)-2-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 162648429 |
| Molecular Formula | C11H13ClN4O4 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (2R,3S,4R,5S)-2-(4-amino-5-chloropyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnn2c([C@H]3O[C@@H](CO)[C@H](O)[C@@H]3O)cc(Cl)c12 |
| InChI | InChI=1S/C11H13ClN4O4/c12-4-1-5(16-7(4)11(13)14-3-15-16)10-9(19)8(18)6(2-17)20-10/h1,3,6,8-10,17-19H,2H2,(H2,13,14,15)/t6-,8-,9-,10+/m0/s1 |
| InChIKey | SCNMZKANWHQNEA-MIBSWOBISA-N |
| XLogP | -0.88 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |