C47H55N11O4 — CID 162648431
8-[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]octanamide (PubChem CID 162648431) has the molecular formula C47H55N11O4 and a molecular weight of 838.03 g/mol. Its IUPAC name is 8-[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]octanamide.
| Compound Name | 8-[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]octanamide |
|---|---|
| PubChem CID | 162648431 |
| Molecular Formula | C47H55N11O4 |
| Molecular Weight | 838.03 g/mol |
| Exact Mass | 837.44 |
| IUPAC Name | 8-[4-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperazin-1-yl]-N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]octanamide |
| SMILES | O=C1CCC(N2Cc3c(NC(=O)CCCCCCCN4CCN(c5ccc(Nc6ncc7nc(Nc8ccccc8)n(C8CCCC8)c7n6)cc5)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C47H55N11O4/c59-41(51-38-17-11-16-36-37(38)31-57(45(36)62)40-23-24-42(60)53-44(40)61)18-7-2-1-3-10-25-55-26-28-56(29-27-55)34-21-19-33(20-22-34)49-46-48-30-39-43(54-46)58(35-14-8-9-15-35)47(52-39)50-32-12-5-4-6-13-32/h4-6,11-13,16-17,19-22,30,35,40H,1-3,7-10,14-15,18,23-29,31H2,(H,50,52)(H,51,59)(H,48,49,54)(H,53,60,61) |
| InChIKey | TWTFDTRUNNZWOY-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.03 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|