C23H28N4O2S — CID 162648499
4-(4-benzylpiperazin-1-yl)-N-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)butanamide (PubChem CID 162648499) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-N-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)butanamide.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-N-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)butanamide |
|---|---|
| PubChem CID | 162648499 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-N-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)butanamide |
| SMILES | Cn1c(=O)sc2cc(NC(=O)CCCN3CCN(Cc4ccccc4)CC3)ccc21 |
| InChI | InChI=1S/C23H28N4O2S/c1-25-20-10-9-19(16-21(20)30-23(25)29)24-22(28)8-5-11-26-12-14-27(15-13-26)17-18-6-3-2-4-7-18/h2-4,6-7,9-10,16H,5,8,11-15,17H2,1H3,(H,24,28) |
| InChIKey | QIFVRBQXNXJGQA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |