C28H24N2O4S — CID 162648592
2-methoxy-5-[(1-methylindol-3-yl)methyl]-N-naphthalen-2-ylsulfonylbenzamide (PubChem CID 162648592) has the molecular formula C28H24N2O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is 2-methoxy-5-[(1-methylindol-3-yl)methyl]-N-naphthalen-2-ylsulfonylbenzamide.
| Compound Name | 2-methoxy-5-[(1-methylindol-3-yl)methyl]-N-naphthalen-2-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 162648592 |
| Molecular Formula | C28H24N2O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-methoxy-5-[(1-methylindol-3-yl)methyl]-N-naphthalen-2-ylsulfonylbenzamide |
| SMILES | COc1ccc(Cc2cn(C)c3ccccc23)cc1C(=O)NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H24N2O4S/c1-30-18-22(24-9-5-6-10-26(24)30)15-19-11-14-27(34-2)25(16-19)28(31)29-35(32,33)23-13-12-20-7-3-4-8-21(20)17-23/h3-14,16-18H,15H2,1-2H3,(H,29,31) |
| InChIKey | LPEYJXLQRLJTKG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |