C14H17ClN2O4 — CID 162648849
5-(4-chlorophenoxy)-N-(2-oxo-1,3-oxazolidin-3-yl)pentanamide (PubChem CID 162648849) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is 5-(4-chlorophenoxy)-N-(2-oxo-1,3-oxazolidin-3-yl)pentanamide.
| Compound Name | 5-(4-chlorophenoxy)-N-(2-oxo-1,3-oxazolidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 162648849 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 5-(4-chlorophenoxy)-N-(2-oxo-1,3-oxazolidin-3-yl)pentanamide |
| SMILES | O=C(CCCCOc1ccc(Cl)cc1)NN1CCOC1=O |
| InChI | InChI=1S/C14H17ClN2O4/c15-11-4-6-12(7-5-11)20-9-2-1-3-13(18)16-17-8-10-21-14(17)19/h4-7H,1-3,8-10H2,(H,16,18) |
| InChIKey | CXVZEJKOMICXRE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|