C20H27FN4O4S — CID 162648898
4-(2-fluoroethyl)-4-hydroxy-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)piperidine-1-carboxamide (PubChem CID 162648898) has the molecular formula C20H27FN4O4S and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-(2-fluoroethyl)-4-hydroxy-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | 4-(2-fluoroethyl)-4-hydroxy-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 162648898 |
| Molecular Formula | C20H27FN4O4S |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-(2-fluoroethyl)-4-hydroxy-N-(4-methoxy-7-morpholin-4-yl-1,3-benzothiazol-2-yl)piperidine-1-carboxamide |
| SMILES | COc1ccc(N2CCOCC2)c2sc(NC(=O)N3CCC(O)(CCF)CC3)nc12 |
| InChI | InChI=1S/C20H27FN4O4S/c1-28-15-3-2-14(24-10-12-29-13-11-24)17-16(15)22-18(30-17)23-19(26)25-8-5-20(27,4-7-21)6-9-25/h2-3,27H,4-13H2,1H3,(H,22,23,26) |
| InChIKey | SARLGQILBNHBNH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|