C17H12N4O — CID 162648911
1-[4-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)phenyl]ethanone (PubChem CID 162648911) has the molecular formula C17H12N4O and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-[4-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)phenyl]ethanone.
| Compound Name | 1-[4-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 162648911 |
| Molecular Formula | C17H12N4O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-[4-(3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-5-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cnc3c4cccnc4nn3c2)cc1 |
| InChI | InChI=1S/C17H12N4O/c1-11(22)12-4-6-13(7-5-12)14-9-19-17-15-3-2-8-18-16(15)20-21(17)10-14/h2-10H,1H3 |
| InChIKey | CGJGTRLHLAPGEE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |