C24H28F4N6O — CID 162649016
(6S,8R)-6-[5-[[1-(3-fluoropropyl)azetidin-3-yl]amino]-2-pyridinyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-5-ol (PubChem CID 162649016) has the molecular formula C24H28F4N6O and a molecular weight of 492.52 g/mol. Its IUPAC name is (6S,8R)-6-[5-[[1-(3-fluoropropyl)azetidin-3-yl]amino]-2-pyridinyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-5-ol.
| Compound Name | (6S,8R)-6-[5-[[1-(3-fluoropropyl)azetidin-3-yl]amino]-2-pyridinyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-5-ol |
|---|---|
| PubChem CID | 162649016 |
| Molecular Formula | C24H28F4N6O |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | (6S,8R)-6-[5-[[1-(3-fluoropropyl)azetidin-3-yl]amino]-2-pyridinyl]-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-5-ol |
| SMILES | C[C@@H]1Cc2c(c(O)cc3[nH]ncc23)[C@@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C24H28F4N6O/c1-14-7-17-18-10-30-32-20(18)8-21(35)22(17)23(34(14)13-24(26,27)28)19-4-3-15(9-29-19)31-16-11-33(12-16)6-2-5-25/h3-4,8-10,14,16,23,31,35H,2,5-7,11-13H2,1H3,(H,30,32)/t14-,23-/m1/s1 |
| InChIKey | KVWNKKQAKBRJNT-QKFKETGDSA-N |
| XLogP | 4.02 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|