2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid

C16H13NO5 — CID 162649127

IUPAC2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid
SMILESCOc1ccc(-c2cccc3c2oc(=O)n3CC(=O)O)cc1
InChIInChI=1S/C16H13NO5/c1-21-11-7-5-10(6-8-11)12-3-2-4-13-15(12)22-16(20)17(13)9-14(18)19/h2-8H,9H2,1H3,(H,18,19)
InChIKeyIFMYHAJFQAMANR-UHFFFAOYSA-N
MW299.28 g/mol
LogP2.35
Rot. Bonds4

About 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid

2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid (PubChem CID 162649127) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid
PubChem CID162649127
Molecular FormulaC16H13NO5
Molecular Weight299.28 g/mol
Exact Mass299.08
IUPAC Name2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid
SMILESCOc1ccc(-c2cccc3c2oc(=O)n3CC(=O)O)cc1
InChIInChI=1S/C16H13NO5/c1-21-11-7-5-10(6-8-11)12-3-2-4-13-15(12)22-16(20)17(13)9-14(18)19/h2-8H,9H2,1H3,(H,18,19)
InChIKeyIFMYHAJFQAMANR-UHFFFAOYSA-N
XLogP2.35
TPSA81.67 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.28
LogP ≤ 52.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid?
The IUPAC name of 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid (CID 162649127) is 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid.
What is the SMILES notation for 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid?
The canonical SMILES for 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid is COc1ccc(-c2cccc3c2oc(=O)n3CC(=O)O)cc1.
What is the InChIKey of 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid?
The InChIKey is IFMYHAJFQAMANR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO5/c1-21-11-7-5-10(6-8-11)12-3-2-4-13-15(12)22-16(20)17(13)9-14(18)19/h2-8H,9H2,1H3,(H,18,19).
What are the key properties of 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid?
2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid has a molecular weight of 299.28 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxazol-3-yl]acetic acid is sourced from PubChem (CID 162649127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).