C13H14BrNO3 — CID 162649140
4-bromo-2-(2,2-dimethylbut-3-enoylamino)benzoic acid (PubChem CID 162649140) has the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. Its IUPAC name is 4-bromo-2-(2,2-dimethylbut-3-enoylamino)benzoic acid.
| Compound Name | 4-bromo-2-(2,2-dimethylbut-3-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 162649140 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 4-bromo-2-(2,2-dimethylbut-3-enoylamino)benzoic acid |
| SMILES | C=CC(C)(C)C(=O)Nc1cc(Br)ccc1C(=O)O |
| InChI | InChI=1S/C13H14BrNO3/c1-4-13(2,3)12(18)15-10-7-8(14)5-6-9(10)11(16)17/h4-7H,1H2,2-3H3,(H,15,18)(H,16,17) |
| InChIKey | OWYAZUUNYLDSNO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|