C9H18N4O2 — CID 162649175
(4R,6R)-4-(4-aminobutyl)-6-methyl-1,2,5-triazepane-3,7-dione (PubChem CID 162649175) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is (4R,6R)-4-(4-aminobutyl)-6-methyl-1,2,5-triazepane-3,7-dione.
| Compound Name | (4R,6R)-4-(4-aminobutyl)-6-methyl-1,2,5-triazepane-3,7-dione |
|---|---|
| PubChem CID | 162649175 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (4R,6R)-4-(4-aminobutyl)-6-methyl-1,2,5-triazepane-3,7-dione |
| SMILES | C[C@H]1N[C@H](CCCCN)C(=O)NNC1=O |
| InChI | InChI=1S/C9H18N4O2/c1-6-8(14)12-13-9(15)7(11-6)4-2-3-5-10/h6-7,11H,2-5,10H2,1H3,(H,12,14)(H,13,15)/t6-,7-/m1/s1 |
| InChIKey | NAKQLLODEYWGIT-RNFRBKRXSA-N |
| XLogP | -1.38 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|