C20H28N4O3S — CID 162649212
(1R,2R,3S,4R,5S)-4-[4-[[(1R)-1-cyclopropylpropyl]amino]-2-methylsulfanylpyrrolo[2,3-d]pyrimidin-7-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol (PubChem CID 162649212) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S)-4-[4-[[(1R)-1-cyclopropylpropyl]amino]-2-methylsulfanylpyrrolo[2,3-d]pyrimidin-7-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol.
| Compound Name | (1R,2R,3S,4R,5S)-4-[4-[[(1R)-1-cyclopropylpropyl]amino]-2-methylsulfanylpyrrolo[2,3-d]pyrimidin-7-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
|---|---|
| PubChem CID | 162649212 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (1R,2R,3S,4R,5S)-4-[4-[[(1R)-1-cyclopropylpropyl]amino]-2-methylsulfanylpyrrolo[2,3-d]pyrimidin-7-yl]-1-(hydroxymethyl)bicyclo[3.1.0]hexane-2,3-diol |
| SMILES | CC[C@@H](Nc1nc(SC)nc2c1ccn2[C@H]1[C@H](O)[C@H](O)[C@]2(CO)C[C@H]12)C1CC1 |
| InChI | InChI=1S/C20H28N4O3S/c1-3-13(10-4-5-10)21-17-11-6-7-24(18(11)23-19(22-17)28-2)14-12-8-20(12,9-25)16(27)15(14)26/h6-7,10,12-16,25-27H,3-5,8-9H2,1-2H3,(H,21,22,23)/t12-,13-,14-,15+,16+,20+/m1/s1 |
| InChIKey | JKXNOWRVGUQDRY-AFQOWECHSA-N |
| XLogP | 2.03 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |