About 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea
1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea (PubChem CID 162649315) has the molecular formula C16H15BrClN3O3
and a molecular weight of 412.67 g/mol. Its IUPAC name is 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea |
| PubChem CID | 162649315 |
| Molecular Formula | C16H15BrClN3O3 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea |
| SMILES | COc1ncc(NC(=O)NC2COc3ccc(Br)cc3C2)cc1Cl |
| InChI | InChI=1S/C16H15BrClN3O3/c1-23-15-13(18)6-11(7-19-15)20-16(22)21-12-5-9-4-10(17)2-3-14(9)24-8-12/h2-4,6-7,12H,5,8H2,1H3,(H2,20,21,22) |
| InChIKey | LLXUUKCOJZHPIK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea?
The IUPAC name of 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea (CID 162649315) is 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea.
What is the SMILES notation for 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea?
The canonical SMILES for 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea is COc1ncc(NC(=O)NC2COc3ccc(Br)cc3C2)cc1Cl.
What is the InChIKey of 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea?
The InChIKey is LLXUUKCOJZHPIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrClN3O3/c1-23-15-13(18)6-11(7-19-15)20-16(22)21-12-5-9-4-10(17)2-3-14(9)24-8-12/h2-4,6-7,12H,5,8H2,1H3,(H2,20,21,22).
What are the key properties of 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea?
1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea has a molecular weight of 412.67 g/mol, XLogP of 3.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-3,4-dihydro-2H-chromen-3-yl)-3-(5-chloro-6-methoxy-3-pyridinyl)urea is sourced from PubChem (CID 162649315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).