C26H46N4O4 — CID 162649428
(3S,6S,12E)-6-methyl-1-(3-methylbutyl)-10-(4-methylpentanoyl)-3-(2-methylpropyl)-1,4,7,10-tetrazacyclotetradec-12-ene-2,5,8-trione (PubChem CID 162649428) has the molecular formula C26H46N4O4 and a molecular weight of 478.68 g/mol. Its IUPAC name is (3S,6S,12E)-6-methyl-1-(3-methylbutyl)-10-(4-methylpentanoyl)-3-(2-methylpropyl)-1,4,7,10-tetrazacyclotetradec-12-ene-2,5,8-trione.
| Compound Name | (3S,6S,12E)-6-methyl-1-(3-methylbutyl)-10-(4-methylpentanoyl)-3-(2-methylpropyl)-1,4,7,10-tetrazacyclotetradec-12-ene-2,5,8-trione |
|---|---|
| PubChem CID | 162649428 |
| Molecular Formula | C26H46N4O4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | (3S,6S,12E)-6-methyl-1-(3-methylbutyl)-10-(4-methylpentanoyl)-3-(2-methylpropyl)-1,4,7,10-tetrazacyclotetradec-12-ene-2,5,8-trione |
| SMILES | CC(C)CCC(=O)N1C/C=C/CN(CCC(C)C)C(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C1 |
| InChI | InChI=1S/C26H46N4O4/c1-18(2)10-11-24(32)30-14-9-8-13-29(15-12-19(3)4)26(34)22(16-20(5)6)28-25(33)21(7)27-23(31)17-30/h8-9,18-22H,10-17H2,1-7H3,(H,27,31)(H,28,33)/b9-8+/t21-,22-/m0/s1 |
| InChIKey | OIJVQMLCPZSNER-CSUCKJSKSA-N |
| XLogP | 2.73 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|