C26H26N2O6 — CID 162649504
(2E,9bR)-6-acetyl-2-[1-[4-(dimethylamino)anilino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 162649504) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is (2E,9bR)-6-acetyl-2-[1-[4-(dimethylamino)anilino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bR)-6-acetyl-2-[1-[4-(dimethylamino)anilino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 162649504 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (2E,9bR)-6-acetyl-2-[1-[4-(dimethylamino)anilino]ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)Nc3ccc(N(C)C)cc3)C(=O)[C@@]12C |
| InChI | InChI=1S/C26H26N2O6/c1-12-22(31)20(14(3)29)24-21(23(12)32)26(4)18(34-24)11-17(30)19(25(26)33)13(2)27-15-7-9-16(10-8-15)28(5)6/h7-11,27,31-32H,1-6H3/b19-13+/t26-/m0/s1 |
| InChIKey | CAXLQCQVRURJBU-WGKDYUSESA-N |
| XLogP | 3.75 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|