About 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide
4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 162649506) has the molecular formula C21H21N5O2S
and a molecular weight of 407.50 g/mol. Its IUPAC name is 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide |
| PubChem CID | 162649506 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Nc3cc(C)nc4cc(C)nn34)cc2)cc1 |
| InChI | InChI=1S/C21H21N5O2S/c1-14-4-6-18(7-5-14)25-29(27,28)19-10-8-17(9-11-19)23-21-12-15(2)22-20-13-16(3)24-26(20)21/h4-13,23,25H,1-3H3 |
| InChIKey | NQOPTOMOOHTLLI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide?
The IUPAC name of 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide (CID 162649506) is 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide.
What is the SMILES notation for 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide?
The canonical SMILES for 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide is Cc1ccc(NS(=O)(=O)c2ccc(Nc3cc(C)nc4cc(C)nn34)cc2)cc1.
What is the InChIKey of 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide?
The InChIKey is NQOPTOMOOHTLLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O2S/c1-14-4-6-18(7-5-14)25-29(27,28)19-10-8-17(9-11-19)23-21-12-15(2)22-20-13-16(3)24-26(20)21/h4-13,23,25H,1-3H3.
What are the key properties of 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide?
4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide has a molecular weight of 407.50 g/mol, XLogP of 4.20, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-yl)amino]-N-(4-methylphenyl)benzenesulfonamide is sourced from PubChem (CID 162649506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).