About 3-bromo-9-nitropyrimido[1,2-b]indazole
3-bromo-9-nitropyrimido[1,2-b]indazole (PubChem CID 162649514) has the molecular formula C10H5BrN4O2
and a molecular weight of 293.08 g/mol. Its IUPAC name is 3-bromo-9-nitropyrimido[1,2-b]indazole.
Molecular Properties
| Compound Name | 3-bromo-9-nitropyrimido[1,2-b]indazole |
| PubChem CID | 162649514 |
| Molecular Formula | C10H5BrN4O2 |
| Molecular Weight | 293.08 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | 3-bromo-9-nitropyrimido[1,2-b]indazole |
| SMILES | O=[N+]([O-])c1ccc2nn3cc(Br)cnc3c2c1 |
| InChI | InChI=1S/C10H5BrN4O2/c11-6-4-12-10-8-3-7(15(16)17)1-2-9(8)13-14(10)5-6/h1-5H |
| InChIKey | MEGDGLIILJKOJZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.08 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-9-nitropyrimido[1,2-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-9-nitropyrimido[1,2-b]indazole?
The IUPAC name of 3-bromo-9-nitropyrimido[1,2-b]indazole (CID 162649514) is 3-bromo-9-nitropyrimido[1,2-b]indazole.
What is the SMILES notation for 3-bromo-9-nitropyrimido[1,2-b]indazole?
The canonical SMILES for 3-bromo-9-nitropyrimido[1,2-b]indazole is O=[N+]([O-])c1ccc2nn3cc(Br)cnc3c2c1.
What is the InChIKey of 3-bromo-9-nitropyrimido[1,2-b]indazole?
The InChIKey is MEGDGLIILJKOJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrN4O2/c11-6-4-12-10-8-3-7(15(16)17)1-2-9(8)13-14(10)5-6/h1-5H.
What are the key properties of 3-bromo-9-nitropyrimido[1,2-b]indazole?
3-bromo-9-nitropyrimido[1,2-b]indazole has a molecular weight of 293.08 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-9-nitropyrimido[1,2-b]indazole is sourced from PubChem (CID 162649514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).