About [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone
[(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone (PubChem CID 162649705) has the molecular formula C25H17ClO2
and a molecular weight of 384.86 g/mol. Its IUPAC name is [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone |
| PubChem CID | 162649705 |
| Molecular Formula | C25H17ClO2 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1Oc2ccc3ccccc3c2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H17ClO2/c26-19-13-10-17(11-14-19)22-23-20-9-5-4-6-16(20)12-15-21(23)28-25(22)24(27)18-7-2-1-3-8-18/h1-15,22,25H/t22-,25-/m0/s1 |
| InChIKey | OPZLKWNJUSGWBL-DHLKQENFSA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone?
The IUPAC name of [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone (CID 162649705) is [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone.
What is the SMILES notation for [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone?
The canonical SMILES for [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone is O=C(c1ccccc1)[C@H]1Oc2ccc3ccccc3c2[C@@H]1c1ccc(Cl)cc1.
What is the InChIKey of [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone?
The InChIKey is OPZLKWNJUSGWBL-DHLKQENFSA-N. The full InChI is InChI=1S/C25H17ClO2/c26-19-13-10-17(11-14-19)22-23-20-9-5-4-6-16(20)12-15-21(23)28-25(22)24(27)18-7-2-1-3-8-18/h1-15,22,25H/t22-,25-/m0/s1.
What are the key properties of [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone?
[(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone has a molecular weight of 384.86 g/mol, XLogP of 6.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-1-(4-chlorophenyl)-1,2-dihydrobenzo[e][1]benzofuran-2-yl]-phenylmethanone is sourced from PubChem (CID 162649705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).